About lanthanum;pentane-2,4-dione;dihydrate
lanthanum;pentane-2,4-dione;dihydrate (PubChem CID 158849371) has the molecular formula C5H12LaO4
and a molecular weight of 275.05 g/mol. Its IUPAC name is lanthanum;pentane-2,4-dione;dihydrate.
Molecular Properties
| Compound Name | lanthanum;pentane-2,4-dione;dihydrate |
| PubChem CID | 158849371 |
| Molecular Formula | C5H12LaO4 |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | lanthanum;pentane-2,4-dione;dihydrate |
| SMILES | CC(=O)CC(C)=O.O.O.[La] |
| InChI | InChI=1S/C5H8O2.La.2H2O/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;;2*1H2 |
| InChIKey | DSZLPCKPJXZPDX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 97.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;pentane-2,4-dione;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;pentane-2,4-dione;dihydrate?
The IUPAC name of lanthanum;pentane-2,4-dione;dihydrate (CID 158849371) is lanthanum;pentane-2,4-dione;dihydrate.
What is the SMILES notation for lanthanum;pentane-2,4-dione;dihydrate?
The canonical SMILES for lanthanum;pentane-2,4-dione;dihydrate is CC(=O)CC(C)=O.O.O.[La].
What is the InChIKey of lanthanum;pentane-2,4-dione;dihydrate?
The InChIKey is DSZLPCKPJXZPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.La.2H2O/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;;2*1H2.
What are the key properties of lanthanum;pentane-2,4-dione;dihydrate?
lanthanum;pentane-2,4-dione;dihydrate has a molecular weight of 275.05 g/mol, XLogP of -1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;pentane-2,4-dione;dihydrate is sourced from PubChem (CID 158849371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).