About pentane-2,4-dione;titanium;tetrahydrate
pentane-2,4-dione;titanium;tetrahydrate (PubChem CID 87923994) has the molecular formula C5H16O6Ti
and a molecular weight of 220.04 g/mol. Its IUPAC name is pentane-2,4-dione;titanium;tetrahydrate.
Molecular Properties
| Compound Name | pentane-2,4-dione;titanium;tetrahydrate |
| PubChem CID | 87923994 |
| Molecular Formula | C5H16O6Ti |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | pentane-2,4-dione;titanium;tetrahydrate |
| SMILES | CC(=O)CC(C)=O.O.O.O.O.[Ti] |
| InChI | InChI=1S/C5H8O2.4H2O.Ti/c1-4(6)3-5(2)7;;;;;/h3H2,1-2H3;4*1H2; |
| InChIKey | YCJKDWKEDAHUFD-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 160.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-dione;titanium;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-dione;titanium;tetrahydrate?
The IUPAC name of pentane-2,4-dione;titanium;tetrahydrate (CID 87923994) is pentane-2,4-dione;titanium;tetrahydrate.
What is the SMILES notation for pentane-2,4-dione;titanium;tetrahydrate?
The canonical SMILES for pentane-2,4-dione;titanium;tetrahydrate is CC(=O)CC(C)=O.O.O.O.O.[Ti].
What is the InChIKey of pentane-2,4-dione;titanium;tetrahydrate?
The InChIKey is YCJKDWKEDAHUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.4H2O.Ti/c1-4(6)3-5(2)7;;;;;/h3H2,1-2H3;4*1H2;.
What are the key properties of pentane-2,4-dione;titanium;tetrahydrate?
pentane-2,4-dione;titanium;tetrahydrate has a molecular weight of 220.04 g/mol, XLogP of -2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;titanium;tetrahydrate is sourced from PubChem (CID 87923994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).