About CID 15855332
CID 15855332 (PubChem CID 15855332) has the molecular formula C10H16O4Sn
and a molecular weight of 318.95 g/mol.
Molecular Properties
| Compound Name | CID 15855332 |
| PubChem CID | 15855332 |
| Molecular Formula | C10H16O4Sn |
| Molecular Weight | 318.95 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | — |
| SMILES | CC(=O)CC(C)=O.CC(=O)CC(C)=O.[Sn] |
| InChI | InChI=1S/2C5H8O2.Sn/c2*1-4(6)3-5(2)7;/h2*3H2,1-2H3; |
| InChIKey | FZMKZAQBIAZQNW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.95 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 15855332 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15855332?
The IUPAC name of CID 15855332 (CID 15855332) is not available.
What is the SMILES notation for CID 15855332?
The canonical SMILES for CID 15855332 is CC(=O)CC(C)=O.CC(=O)CC(C)=O.[Sn].
What is the InChIKey of CID 15855332?
The InChIKey is FZMKZAQBIAZQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8O2.Sn/c2*1-4(6)3-5(2)7;/h2*3H2,1-2H3;.
What are the key properties of CID 15855332?
CID 15855332 has a molecular weight of 318.95 g/mol, XLogP of 0.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15855332 is sourced from PubChem (CID 15855332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).