About potassium pentane-2,4-dione
potassium pentane-2,4-dione (PubChem CID 19762724) has the molecular formula C5H8KO2+
and a molecular weight of 139.22 g/mol. Its IUPAC name is potassium pentane-2,4-dione.
Molecular Properties
| Compound Name | potassium pentane-2,4-dione |
| PubChem CID | 19762724 |
| Molecular Formula | C5H8KO2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | potassium pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.[K+] |
| InChI | InChI=1S/C5H8O2.K/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1 |
| InChIKey | MRUJNIAKPWYVIK-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium pentane-2,4-dione?
The IUPAC name of potassium pentane-2,4-dione (CID 19762724) is potassium pentane-2,4-dione.
What is the SMILES notation for potassium pentane-2,4-dione?
The canonical SMILES for potassium pentane-2,4-dione is CC(=O)CC(C)=O.[K+].
What is the InChIKey of potassium pentane-2,4-dione?
The InChIKey is MRUJNIAKPWYVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.K/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1.
What are the key properties of potassium pentane-2,4-dione?
potassium pentane-2,4-dione has a molecular weight of 139.22 g/mol, XLogP of -2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium pentane-2,4-dione is sourced from PubChem (CID 19762724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).