About methylazanide;pentane-2,4-dione;yttrium
methylazanide;pentane-2,4-dione;yttrium (PubChem CID 158650555) has the molecular formula C7H16N2O2Y-2
and a molecular weight of 249.12 g/mol. Its IUPAC name is methylazanide;pentane-2,4-dione;yttrium.
Molecular Properties
| Compound Name | methylazanide;pentane-2,4-dione;yttrium |
| PubChem CID | 158650555 |
| Molecular Formula | C7H16N2O2Y-2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | methylazanide;pentane-2,4-dione;yttrium |
| SMILES | CC(=O)CC(C)=O.C[NH-].C[NH-].[Y] |
| InChI | InChI=1S/C5H8O2.2CH4N.Y/c1-4(6)3-5(2)7;2*1-2;/h3H2,1-2H3;2*2H,1H3;/q;2*-1; |
| InChIKey | UODKHXRAFDGPCN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methylazanide;pentane-2,4-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanide;pentane-2,4-dione;yttrium?
The IUPAC name of methylazanide;pentane-2,4-dione;yttrium (CID 158650555) is methylazanide;pentane-2,4-dione;yttrium.
What is the SMILES notation for methylazanide;pentane-2,4-dione;yttrium?
The canonical SMILES for methylazanide;pentane-2,4-dione;yttrium is CC(=O)CC(C)=O.C[NH-].C[NH-].[Y].
What is the InChIKey of methylazanide;pentane-2,4-dione;yttrium?
The InChIKey is UODKHXRAFDGPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.2CH4N.Y/c1-4(6)3-5(2)7;2*1-2;/h3H2,1-2H3;2*2H,1H3;/q;2*-1;.
What are the key properties of methylazanide;pentane-2,4-dione;yttrium?
methylazanide;pentane-2,4-dione;yttrium has a molecular weight of 249.12 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanide;pentane-2,4-dione;yttrium is sourced from PubChem (CID 158650555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).