About silver pentane-2,4-dione
silver pentane-2,4-dione (PubChem CID 21252539) has the molecular formula C5H8AgO2+
and a molecular weight of 207.98 g/mol. Its IUPAC name is silver pentane-2,4-dione.
Molecular Properties
| Compound Name | silver pentane-2,4-dione |
| PubChem CID | 21252539 |
| Molecular Formula | C5H8AgO2+ |
| Molecular Weight | 207.98 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | silver pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.[Ag+] |
| InChI | InChI=1S/C5H8O2.Ag/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1 |
| InChIKey | IPYOWMADDMITJJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.98 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze silver pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver pentane-2,4-dione?
The IUPAC name of silver pentane-2,4-dione (CID 21252539) is silver pentane-2,4-dione.
What is the SMILES notation for silver pentane-2,4-dione?
The canonical SMILES for silver pentane-2,4-dione is CC(=O)CC(C)=O.[Ag+].
What is the InChIKey of silver pentane-2,4-dione?
The InChIKey is IPYOWMADDMITJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Ag/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1.
What are the key properties of silver pentane-2,4-dione?
silver pentane-2,4-dione has a molecular weight of 207.98 g/mol, XLogP of 0.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver pentane-2,4-dione is sourced from PubChem (CID 21252539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).