About cerium;pentane-2,4-dione;hydrate
cerium;pentane-2,4-dione;hydrate (PubChem CID 86734909) has the molecular formula C5H10CeO3
and a molecular weight of 258.25 g/mol. Its IUPAC name is cerium;pentane-2,4-dione;hydrate.
Molecular Properties
| Compound Name | cerium;pentane-2,4-dione;hydrate |
| PubChem CID | 86734909 |
| Molecular Formula | C5H10CeO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | cerium;pentane-2,4-dione;hydrate |
| SMILES | CC(=O)CC(C)=O.O.[Ce] |
| InChI | InChI=1S/C5H8O2.Ce.H2O/c1-4(6)3-5(2)7;;/h3H2,1-2H3;;1H2 |
| InChIKey | VOSUUQCOMGVLQQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cerium;pentane-2,4-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;pentane-2,4-dione;hydrate?
The IUPAC name of cerium;pentane-2,4-dione;hydrate (CID 86734909) is cerium;pentane-2,4-dione;hydrate.
What is the SMILES notation for cerium;pentane-2,4-dione;hydrate?
The canonical SMILES for cerium;pentane-2,4-dione;hydrate is CC(=O)CC(C)=O.O.[Ce].
What is the InChIKey of cerium;pentane-2,4-dione;hydrate?
The InChIKey is VOSUUQCOMGVLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Ce.H2O/c1-4(6)3-5(2)7;;/h3H2,1-2H3;;1H2.
What are the key properties of cerium;pentane-2,4-dione;hydrate?
cerium;pentane-2,4-dione;hydrate has a molecular weight of 258.25 g/mol, XLogP of -0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;pentane-2,4-dione;hydrate is sourced from PubChem (CID 86734909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).