C6H9N — CID 159945395
formonitrile;2-methylbuta-1,3-diene (PubChem CID 159945395) has the molecular formula C6H9N and a molecular weight of 95.14 g/mol. Its IUPAC name is formonitrile;2-methylbuta-1,3-diene.
| Compound Name | formonitrile;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 159945395 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | formonitrile;2-methylbuta-1,3-diene |
| SMILES | C#N.C=CC(=C)C |
| InChI | InChI=1S/C5H8.CHN/c1-4-5(2)3;1-2/h4H,1-2H2,3H3;1H |
| InChIKey | OBKLJFLBOQFDCI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|