C9H15F — CID 144585247
3-fluoro-2-methylprop-1-ene;2-methylbuta-1,3-diene (PubChem CID 144585247) has the molecular formula C9H15F and a molecular weight of 142.22 g/mol. Its IUPAC name is 3-fluoro-2-methylprop-1-ene;2-methylbuta-1,3-diene.
| Compound Name | 3-fluoro-2-methylprop-1-ene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 144585247 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 3-fluoro-2-methylprop-1-ene;2-methylbuta-1,3-diene |
| SMILES | C=C(C)CF.C=CC(=C)C |
| InChI | InChI=1S/C5H8.C4H7F/c1-4-5(2)3;1-4(2)3-5/h4H,1-2H2,3H3;1,3H2,2H3 |
| InChIKey | SENAINFOWAKQJY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|