C15H24 — CID 163756056
buta-1,3-diene;2,3-dimethylbuta-1,3-diene;2-methylbuta-1,3-diene (PubChem CID 163756056) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is buta-1,3-diene;2,3-dimethylbuta-1,3-diene;2-methylbuta-1,3-diene.
| Compound Name | buta-1,3-diene;2,3-dimethylbuta-1,3-diene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 163756056 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | buta-1,3-diene;2,3-dimethylbuta-1,3-diene;2-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=C)C.C=CC(=C)C.C=CC=C |
| InChI | InChI=1S/C6H10.C5H8.C4H6/c1-5(2)6(3)4;1-4-5(2)3;1-3-4-2/h1,3H2,2,4H3;4H,1-2H2,3H3;3-4H,1-2H2 |
| InChIKey | LUDASEDUQNETGZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|