C7H14O — CID 159763877
methoxymethane;2-methylbuta-1,3-diene (PubChem CID 159763877) has the molecular formula C7H14O and a molecular weight of 114.19 g/mol. Its IUPAC name is methoxymethane;2-methylbuta-1,3-diene.
| Compound Name | methoxymethane;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 159763877 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | methoxymethane;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.COC |
| InChI | InChI=1S/C5H8.C2H6O/c1-4-5(2)3;1-3-2/h4H,1-2H2,3H3;1-2H3 |
| InChIKey | NFGBHZVAAHKFCH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|