C9H15F — CID 142535063
(E)-2-fluorobut-2-ene;2-methylbuta-1,3-diene (PubChem CID 142535063) has the molecular formula C9H15F and a molecular weight of 142.22 g/mol. Its IUPAC name is (E)-2-fluorobut-2-ene;2-methylbuta-1,3-diene.
| Compound Name | (E)-2-fluorobut-2-ene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 142535063 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (E)-2-fluorobut-2-ene;2-methylbuta-1,3-diene |
| SMILES | C/C=C(\C)F.C=CC(=C)C |
| InChI | InChI=1S/C5H8.C4H7F/c1-4-5(2)3;1-3-4(2)5/h4H,1-2H2,3H3;3H,1-2H3/b;4-3+ |
| InChIKey | VQBKSLCJBZRYRL-SCBDLNNBSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|