C4H5F — CID 551655
2-fluorobuta-1,3-diene (PubChem CID 551655) has the molecular formula C4H5F and a molecular weight of 72.08 g/mol. Its IUPAC name is 2-fluorobuta-1,3-diene.
| Compound Name | 2-fluorobuta-1,3-diene |
|---|---|
| PubChem CID | 551655 |
| Molecular Formula | C4H5F |
| Molecular Weight | 72.08 g/mol |
| Exact Mass | 72.04 |
| IUPAC Name | 2-fluorobuta-1,3-diene |
| SMILES | C=CC(=C)F |
| InChI | InChI=1S/C4H5F/c1-3-4(2)5/h3H,1-2H2 |
| InChIKey | BQHQZFUAEAVJRE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 72.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|