C9H16FN — CID 144685444
2-fluorobuta-1,3-diene;3-methylbut-3-en-1-amine (PubChem CID 144685444) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 2-fluorobuta-1,3-diene;3-methylbut-3-en-1-amine.
| Compound Name | 2-fluorobuta-1,3-diene;3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 144685444 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-fluorobuta-1,3-diene;3-methylbut-3-en-1-amine |
| SMILES | C=C(C)CCN.C=CC(=C)F |
| InChI | InChI=1S/C5H11N.C4H5F/c1-5(2)3-4-6;1-3-4(2)5/h1,3-4,6H2,2H3;3H,1-2H2 |
| InChIKey | QTJYEDCJZUDDRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|