About methane;2-methylpent-1-ene;bis(prop-1-ene)
methane;2-methylpent-1-ene;bis(prop-1-ene) (PubChem CID 159090973) has the molecular formula C15H36
and a molecular weight of 216.45 g/mol. Its IUPAC name is methane;2-methylpent-1-ene;bis(prop-1-ene).
Molecular Properties
| Compound Name | methane;2-methylpent-1-ene;bis(prop-1-ene) |
| PubChem CID | 159090973 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | methane;2-methylpent-1-ene;bis(prop-1-ene) |
| SMILES | C.C.C.C=C(C)CCC.C=CC.C=CC |
| InChI | InChI=1S/C6H12.2C3H6.3CH4/c1-4-5-6(2)3;2*1-3-2;;;/h2,4-5H2,1,3H3;2*3H,1H2,2H3;3*1H4 |
| InChIKey | KCAZFDRGNGXSIZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylpent-1-ene;bis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpent-1-ene;bis(prop-1-ene)?
The IUPAC name of methane;2-methylpent-1-ene;bis(prop-1-ene) (CID 159090973) is methane;2-methylpent-1-ene;bis(prop-1-ene).
What is the SMILES notation for methane;2-methylpent-1-ene;bis(prop-1-ene)?
The canonical SMILES for methane;2-methylpent-1-ene;bis(prop-1-ene) is C.C.C.C=C(C)CCC.C=CC.C=CC.
What is the InChIKey of methane;2-methylpent-1-ene;bis(prop-1-ene)?
The InChIKey is KCAZFDRGNGXSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.2C3H6.3CH4/c1-4-5-6(2)3;2*1-3-2;;;/h2,4-5H2,1,3H3;2*3H,1H2,2H3;3*1H4.
What are the key properties of methane;2-methylpent-1-ene;bis(prop-1-ene)?
methane;2-methylpent-1-ene;bis(prop-1-ene) has a molecular weight of 216.45 g/mol, XLogP of 6.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpent-1-ene;bis(prop-1-ene) is sourced from PubChem (CID 159090973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).