About methane;(Z)-3-methylpent-2-ene;prop-1-ene
methane;(Z)-3-methylpent-2-ene;prop-1-ene (PubChem CID 142993133) has the molecular formula C10H22
and a molecular weight of 142.29 g/mol. Its IUPAC name is methane;(Z)-3-methylpent-2-ene;prop-1-ene.
Molecular Properties
| Compound Name | methane;(Z)-3-methylpent-2-ene;prop-1-ene |
| PubChem CID | 142993133 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | methane;(Z)-3-methylpent-2-ene;prop-1-ene |
| SMILES | C.C/C=C(/C)CC.C=CC |
| InChI | InChI=1S/C6H12.C3H6.CH4/c1-4-6(3)5-2;1-3-2;/h4H,5H2,1-3H3;3H,1H2,2H3;1H4/b6-4-;; |
| InChIKey | BLHJCSHAMHXVFH-XFUGJFOESA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;(Z)-3-methylpent-2-ene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(Z)-3-methylpent-2-ene;prop-1-ene?
The IUPAC name of methane;(Z)-3-methylpent-2-ene;prop-1-ene (CID 142993133) is methane;(Z)-3-methylpent-2-ene;prop-1-ene.
What is the SMILES notation for methane;(Z)-3-methylpent-2-ene;prop-1-ene?
The canonical SMILES for methane;(Z)-3-methylpent-2-ene;prop-1-ene is C.C/C=C(/C)CC.C=CC.
What is the InChIKey of methane;(Z)-3-methylpent-2-ene;prop-1-ene?
The InChIKey is BLHJCSHAMHXVFH-XFUGJFOESA-N. The full InChI is InChI=1S/C6H12.C3H6.CH4/c1-4-6(3)5-2;1-3-2;/h4H,5H2,1-3H3;3H,1H2,2H3;1H4/b6-4-;;.
What are the key properties of methane;(Z)-3-methylpent-2-ene;prop-1-ene?
methane;(Z)-3-methylpent-2-ene;prop-1-ene has a molecular weight of 142.29 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(Z)-3-methylpent-2-ene;prop-1-ene is sourced from PubChem (CID 142993133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).