C16H33F — CID 143341985
ethane;(3Z)-3-fluorohexa-1,3-diene;(E)-3-methylpent-2-ene (PubChem CID 143341985) has the molecular formula C16H33F and a molecular weight of 244.44 g/mol. Its IUPAC name is ethane;(3Z)-3-fluorohexa-1,3-diene;(E)-3-methylpent-2-ene.
| Compound Name | ethane;(3Z)-3-fluorohexa-1,3-diene;(E)-3-methylpent-2-ene |
|---|---|
| PubChem CID | 143341985 |
| Molecular Formula | C16H33F |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | ethane;(3Z)-3-fluorohexa-1,3-diene;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.C=C/C(F)=C/CC.CC.CC |
| InChI | InChI=1S/C6H9F.C6H12.2C2H6/c1-3-5-6(7)4-2;1-4-6(3)5-2;2*1-2/h4-5H,2-3H2,1H3;4H,5H2,1-3H3;2*1-2H3/b6-5-;6-4+;; |
| InChIKey | OCRKXTLQOQCQOQ-ZQUSHYAPSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|