About ethane;3-methylpent-2-ene;propane
ethane;3-methylpent-2-ene;propane (PubChem CID 144514263) has the molecular formula C14H34
and a molecular weight of 202.43 g/mol. Its IUPAC name is ethane;3-methylpent-2-ene;propane.
Molecular Properties
| Compound Name | ethane;3-methylpent-2-ene;propane |
| PubChem CID | 144514263 |
| Molecular Formula | C14H34 |
| Molecular Weight | 202.43 g/mol |
| Exact Mass | 202.27 |
| IUPAC Name | ethane;3-methylpent-2-ene;propane |
| SMILES | CC.CC=C(C)CC.CCC.CCC |
| InChI | InChI=1S/C6H12.2C3H8.C2H6/c1-4-6(3)5-2;2*1-3-2;1-2/h4H,5H2,1-3H3;2*3H2,1-2H3;1-2H3 |
| InChIKey | VTNITXQKBRHNJI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylpent-2-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylpent-2-ene;propane?
The IUPAC name of ethane;3-methylpent-2-ene;propane (CID 144514263) is ethane;3-methylpent-2-ene;propane.
What is the SMILES notation for ethane;3-methylpent-2-ene;propane?
The canonical SMILES for ethane;3-methylpent-2-ene;propane is CC.CC=C(C)CC.CCC.CCC.
What is the InChIKey of ethane;3-methylpent-2-ene;propane?
The InChIKey is VTNITXQKBRHNJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.2C3H8.C2H6/c1-4-6(3)5-2;2*1-3-2;1-2/h4H,5H2,1-3H3;2*3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-methylpent-2-ene;propane?
ethane;3-methylpent-2-ene;propane has a molecular weight of 202.43 g/mol, XLogP of 6.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylpent-2-ene;propane is sourced from PubChem (CID 144514263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).