C12H26 — CID 145177084
(3Z)-2,4-dimethylhexa-1,3-diene;ethane (PubChem CID 145177084) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is (3Z)-2,4-dimethylhexa-1,3-diene;ethane.
| Compound Name | (3Z)-2,4-dimethylhexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 145177084 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | (3Z)-2,4-dimethylhexa-1,3-diene;ethane |
| SMILES | C=C(C)/C=C(/C)CC.CC.CC |
| InChI | InChI=1S/C8H14.2C2H6/c1-5-8(4)6-7(2)3;2*1-2/h6H,2,5H2,1,3-4H3;2*1-2H3/b8-6-;; |
| InChIKey | QWCFAUQWGXDVML-OTDBEEGXSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|