C13H30 — CID 144511028
2,4-dimethylpenta-1,3-diene;ethane (PubChem CID 144511028) has the molecular formula C13H30 and a molecular weight of 186.38 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,3-diene;ethane.
| Compound Name | 2,4-dimethylpenta-1,3-diene;ethane |
|---|---|
| PubChem CID | 144511028 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 2,4-dimethylpenta-1,3-diene;ethane |
| SMILES | C=C(C)C=C(C)C.CC.CC.CC |
| InChI | InChI=1S/C7H12.3C2H6/c1-6(2)5-7(3)4;3*1-2/h5H,1H2,2-4H3;3*1-2H3 |
| InChIKey | KTXUWVRQQCPKNC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|