C9H15BrO — CID 143693486
(3E)-3-bromo-5-methylhexa-1,3,5-trien-2-ol;ethane (PubChem CID 143693486) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is (3E)-3-bromo-5-methylhexa-1,3,5-trien-2-ol;ethane.
| Compound Name | (3E)-3-bromo-5-methylhexa-1,3,5-trien-2-ol;ethane |
|---|---|
| PubChem CID | 143693486 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (3E)-3-bromo-5-methylhexa-1,3,5-trien-2-ol;ethane |
| SMILES | C=C(C)/C=C(/Br)C(=C)O.CC |
| InChI | InChI=1S/C7H9BrO.C2H6/c1-5(2)4-7(8)6(3)9;1-2/h4,9H,1,3H2,2H3;1-2H3/b7-4+; |
| InChIKey | QTZTTWPLVZINIF-KQGICBIGSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|