C9H14BrN — CID 145268848
(3E)-3-bromo-N-ethyl-5-methylhexa-1,3,5-trien-2-amine (PubChem CID 145268848) has the molecular formula C9H14BrN and a molecular weight of 216.12 g/mol. Its IUPAC name is (3E)-3-bromo-N-ethyl-5-methylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-3-bromo-N-ethyl-5-methylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 145268848 |
| Molecular Formula | C9H14BrN |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (3E)-3-bromo-N-ethyl-5-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C(/Br)C(=C)NCC |
| InChI | InChI=1S/C9H14BrN/c1-5-11-8(4)9(10)6-7(2)3/h6,11H,2,4-5H2,1,3H3/b9-6+ |
| InChIKey | DYSVVIAIAKEZMN-RMKNXTFCSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|