C15H30 — CID 144632740
ethane;(3Z,5Z)-5-ethyl-2,4-dimethylhepta-1,3,5-triene (PubChem CID 144632740) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is ethane;(3Z,5Z)-5-ethyl-2,4-dimethylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-5-ethyl-2,4-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144632740 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | ethane;(3Z,5Z)-5-ethyl-2,4-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C(C)\C(=C/C)CC.CC.CC |
| InChI | InChI=1S/C11H18.2C2H6/c1-6-11(7-2)10(5)8-9(3)4;2*1-2/h6,8H,3,7H2,1-2,4-5H3;2*1-2H3/b10-8-,11-6-;; |
| InChIKey | YIXGDIAQGWCHBR-NSHSSHBYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|