C10H15Cl — CID 144845951
(3E,5Z)-3-chloro-5-ethyl-4-methylhepta-1,3,5-triene (PubChem CID 144845951) has the molecular formula C10H15Cl and a molecular weight of 170.68 g/mol. Its IUPAC name is (3E,5Z)-3-chloro-5-ethyl-4-methylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-chloro-5-ethyl-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144845951 |
| Molecular Formula | C10H15Cl |
| Molecular Weight | 170.68 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3E,5Z)-3-chloro-5-ethyl-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(C)\C(=C/C)CC |
| InChI | InChI=1S/C10H15Cl/c1-5-9(6-2)8(4)10(11)7-3/h5,7H,3,6H2,1-2,4H3/b9-5-,10-8+ |
| InChIKey | NDAWPXDEHLSORD-APQBBXBWSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|