About 3,4,5-trichloropenta-1,3-diene
3,4,5-trichloropenta-1,3-diene (PubChem CID 174775530) has the molecular formula C5H5Cl3
and a molecular weight of 171.45 g/mol. Its IUPAC name is 3,4,5-trichloropenta-1,3-diene.
Molecular Properties
| Compound Name | 3,4,5-trichloropenta-1,3-diene |
| PubChem CID | 174775530 |
| Molecular Formula | C5H5Cl3 |
| Molecular Weight | 171.45 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | 3,4,5-trichloropenta-1,3-diene |
| SMILES | C=CC(Cl)=C(Cl)CCl |
| InChI | InChI=1S/C5H5Cl3/c1-2-4(7)5(8)3-6/h2H,1,3H2 |
| InChIKey | OLTPKYOANSYLGH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trichloropenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trichloropenta-1,3-diene?
The IUPAC name of 3,4,5-trichloropenta-1,3-diene (CID 174775530) is 3,4,5-trichloropenta-1,3-diene.
What is the SMILES notation for 3,4,5-trichloropenta-1,3-diene?
The canonical SMILES for 3,4,5-trichloropenta-1,3-diene is C=CC(Cl)=C(Cl)CCl.
What is the InChIKey of 3,4,5-trichloropenta-1,3-diene?
The InChIKey is OLTPKYOANSYLGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl3/c1-2-4(7)5(8)3-6/h2H,1,3H2.
What are the key properties of 3,4,5-trichloropenta-1,3-diene?
3,4,5-trichloropenta-1,3-diene has a molecular weight of 171.45 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trichloropenta-1,3-diene is sourced from PubChem (CID 174775530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).