C8H12ClN — CID 142239286
(3E)-4-chloro-N,3-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 142239286) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is (3E)-4-chloro-N,3-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-chloro-N,3-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142239286 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3E)-4-chloro-N,3-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(Cl)=C(/C)C(=C)NC |
| InChI | InChI=1S/C8H12ClN/c1-5-8(9)6(2)7(3)10-4/h5,10H,1,3H2,2,4H3/b8-6+ |
| InChIKey | QBFKKDIQIIJFOH-SOFGYWHQSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|