C5H6Cl2 — CID 167302623
(3E)-3,4-dichloropenta-1,3-diene (PubChem CID 167302623) has the molecular formula C5H6Cl2 and a molecular weight of 137.01 g/mol. Its IUPAC name is (3E)-3,4-dichloropenta-1,3-diene.
| Compound Name | (3E)-3,4-dichloropenta-1,3-diene |
|---|---|
| PubChem CID | 167302623 |
| Molecular Formula | C5H6Cl2 |
| Molecular Weight | 137.01 g/mol |
| Exact Mass | 135.98 |
| IUPAC Name | (3E)-3,4-dichloropenta-1,3-diene |
| SMILES | C=C/C(Cl)=C(/C)Cl |
| InChI | InChI=1S/C5H6Cl2/c1-3-5(7)4(2)6/h3H,1H2,2H3/b5-4+ |
| InChIKey | KIBKBTMHNMFCHQ-SNAWJCMRSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.01 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|