C9H11Cl — CID 142076420
(3E)-3-chloro-6-methyl-5-methylidenehepta-1,3,6-triene (PubChem CID 142076420) has the molecular formula C9H11Cl and a molecular weight of 154.64 g/mol. Its IUPAC name is (3E)-3-chloro-6-methyl-5-methylidenehepta-1,3,6-triene.
| Compound Name | (3E)-3-chloro-6-methyl-5-methylidenehepta-1,3,6-triene |
|---|---|
| PubChem CID | 142076420 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (3E)-3-chloro-6-methyl-5-methylidenehepta-1,3,6-triene |
| SMILES | C=C/C(Cl)=C\C(=C)C(=C)C |
| InChI | InChI=1S/C9H11Cl/c1-5-9(10)6-8(4)7(2)3/h5-6H,1-2,4H2,3H3/b9-6+ |
| InChIKey | VFVUUUQZEZFJCK-RMKNXTFCSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|