C10H14O — CID 143344295
(3E)-3,6-dimethyl-5-methylidenehepta-3,6-dien-2-one (PubChem CID 143344295) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (3E)-3,6-dimethyl-5-methylidenehepta-3,6-dien-2-one.
| Compound Name | (3E)-3,6-dimethyl-5-methylidenehepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 143344295 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (3E)-3,6-dimethyl-5-methylidenehepta-3,6-dien-2-one |
| SMILES | C=C(C)C(=C)/C=C(\C)C(C)=O |
| InChI | InChI=1S/C10H14O/c1-7(2)8(3)6-9(4)10(5)11/h6H,1,3H2,2,4-5H3/b9-6+ |
| InChIKey | ZAGKQOQULPBIIA-RMKNXTFCSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|