C14H21N — CID 126727778
N-[(2Z,4Z)-3,4,7-trimethyl-6-methylideneocta-2,4,7-trienyl]ethanimine (PubChem CID 126727778) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-[(2Z,4Z)-3,4,7-trimethyl-6-methylideneocta-2,4,7-trienyl]ethanimine.
| Compound Name | N-[(2Z,4Z)-3,4,7-trimethyl-6-methylideneocta-2,4,7-trienyl]ethanimine |
|---|---|
| PubChem CID | 126727778 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-[(2Z,4Z)-3,4,7-trimethyl-6-methylideneocta-2,4,7-trienyl]ethanimine |
| SMILES | C=C(C)C(=C)/C=C(C)\C(C)=C/C/N=C/C |
| InChI | InChI=1S/C14H21N/c1-7-15-9-8-12(4)14(6)10-13(5)11(2)3/h7-8,10H,2,5,9H2,1,3-4,6H3/b12-8-,14-10-,15-7+ |
| InChIKey | QWYRBPPUKONNGO-YPPSAFIESA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|