C11H15FO — CID 144980618
(4E)-4-fluoro-7-methyl-3,6-dimethylideneocta-4,7-dien-1-ol (PubChem CID 144980618) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is (4E)-4-fluoro-7-methyl-3,6-dimethylideneocta-4,7-dien-1-ol.
| Compound Name | (4E)-4-fluoro-7-methyl-3,6-dimethylideneocta-4,7-dien-1-ol |
|---|---|
| PubChem CID | 144980618 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (4E)-4-fluoro-7-methyl-3,6-dimethylideneocta-4,7-dien-1-ol |
| SMILES | C=C(C)C(=C)/C=C(/F)C(=C)CCO |
| InChI | InChI=1S/C11H15FO/c1-8(2)10(4)7-11(12)9(3)5-6-13/h7,13H,1,3-6H2,2H3/b11-7+ |
| InChIKey | UKFLHHJXXHWBIK-YRNVUSSQSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|