About 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol
5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol (PubChem CID 78385142) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol |
| PubChem CID | 78385142 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol |
| SMILES | C=C(C)C=CC(CO)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-8(2)5-6-10(7-11)9(3)4/h5-6,10-11H,1,3,7H2,2,4H3 |
| InChIKey | KBVFHOKBXAUWHI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol?
The IUPAC name of 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol (CID 78385142) is 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol.
What is the SMILES notation for 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol?
The canonical SMILES for 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol is C=C(C)C=CC(CO)C(=C)C.
What is the InChIKey of 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol?
The InChIKey is KBVFHOKBXAUWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-8(2)5-6-10(7-11)9(3)4/h5-6,10-11H,1,3,7H2,2,4H3.
What are the key properties of 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol?
5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol has a molecular weight of 152.24 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-prop-1-en-2-ylhexa-3,5-dien-1-ol is sourced from PubChem (CID 78385142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).