About (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol
(3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol (PubChem CID 89416424) has the molecular formula C8H11FO
and a molecular weight of 142.17 g/mol. Its IUPAC name is (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol |
| PubChem CID | 89416424 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol |
| SMILES | C=C(/C=C\C(F)=C/C)CO |
| InChI | InChI=1S/C8H11FO/c1-3-8(9)5-4-7(2)6-10/h3-5,10H,2,6H2,1H3/b5-4-,8-3+ |
| InChIKey | ZARYKKUENCHFRA-UEQFWHKLSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol?
The IUPAC name of (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol (CID 89416424) is (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol.
What is the SMILES notation for (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol?
The canonical SMILES for (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol is C=C(/C=C\C(F)=C/C)CO.
What is the InChIKey of (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol?
The InChIKey is ZARYKKUENCHFRA-UEQFWHKLSA-N. The full InChI is InChI=1S/C8H11FO/c1-3-8(9)5-4-7(2)6-10/h3-5,10H,2,6H2,1H3/b5-4-,8-3+.
What are the key properties of (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol?
(3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol has a molecular weight of 142.17 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-fluoro-2-methylidenehepta-3,5-dien-1-ol is sourced from PubChem (CID 89416424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).