C8H12O2 — CID 122535316
(3Z,5Z)-4-methylhepta-1,3,5-triene-2,5-diol (PubChem CID 122535316) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3Z,5Z)-4-methylhepta-1,3,5-triene-2,5-diol.
| Compound Name | (3Z,5Z)-4-methylhepta-1,3,5-triene-2,5-diol |
|---|---|
| PubChem CID | 122535316 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3Z,5Z)-4-methylhepta-1,3,5-triene-2,5-diol |
| SMILES | C=C(O)/C=C(C)\C(O)=C\C |
| InChI | InChI=1S/C8H12O2/c1-4-8(10)6(2)5-7(3)9/h4-5,9-10H,3H2,1-2H3/b6-5-,8-4- |
| InChIKey | IDVFRTWWZLLAAI-QUXRQYFZSA-N |
| XLogP | 2.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|