C9H16O2 — CID 143687304
ethane;(3E)-5-methylhexa-1,3,5-triene-2,4-diol (PubChem CID 143687304) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is ethane;(3E)-5-methylhexa-1,3,5-triene-2,4-diol.
| Compound Name | ethane;(3E)-5-methylhexa-1,3,5-triene-2,4-diol |
|---|---|
| PubChem CID | 143687304 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethane;(3E)-5-methylhexa-1,3,5-triene-2,4-diol |
| SMILES | C=C(O)/C=C(/O)C(=C)C.CC |
| InChI | InChI=1S/C7H10O2.C2H6/c1-5(2)7(9)4-6(3)8;1-2/h4,8-9H,1,3H2,2H3;1-2H3/b7-4+; |
| InChIKey | FWCSEWMJVLTYSF-KQGICBIGSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|