C10H16O2 — CID 169155574
ethane;(3E)-3-ethenyl-5-hydroxyhexa-3,5-dien-2-one (PubChem CID 169155574) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-5-hydroxyhexa-3,5-dien-2-one.
| Compound Name | ethane;(3E)-3-ethenyl-5-hydroxyhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 169155574 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | ethane;(3E)-3-ethenyl-5-hydroxyhexa-3,5-dien-2-one |
| SMILES | C=C/C(=C\C(=C)O)C(C)=O.CC |
| InChI | InChI=1S/C8H10O2.C2H6/c1-4-8(7(3)10)5-6(2)9;1-2/h4-5,9H,1-2H2,3H3;1-2H3/b8-5+; |
| InChIKey | SYODTJFXQQAFFS-HAAWTFQLSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|