C11H14O2 — CID 144874397
(2E,4E)-5-ethenyl-2,6-dimethylhepta-2,4,6-trienoic acid (PubChem CID 144874397) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2E,4E)-5-ethenyl-2,6-dimethylhepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E)-5-ethenyl-2,6-dimethylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 144874397 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2E,4E)-5-ethenyl-2,6-dimethylhepta-2,4,6-trienoic acid |
| SMILES | C=C/C(=C\C=C(/C)C(=O)O)C(=C)C |
| InChI | InChI=1S/C11H14O2/c1-5-10(8(2)3)7-6-9(4)11(12)13/h5-7H,1-2H2,3-4H3,(H,12,13)/b9-6+,10-7+ |
| InChIKey | VCHFNRHCNZTZJN-KZZDLZNXSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|