C9H13NO2 — CID 166647606
(2E,4Z)-2-ethenyl-5-(methylamino)hexa-2,4-dienoic acid (PubChem CID 166647606) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-5-(methylamino)hexa-2,4-dienoic acid.
| Compound Name | (2E,4Z)-2-ethenyl-5-(methylamino)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 166647606 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (2E,4Z)-2-ethenyl-5-(methylamino)hexa-2,4-dienoic acid |
| SMILES | C=C/C(=C\C=C(\C)NC)C(=O)O |
| InChI | InChI=1S/C9H13NO2/c1-4-8(9(11)12)6-5-7(2)10-3/h4-6,10H,1H2,2-3H3,(H,11,12)/b7-5-,8-6+ |
| InChIKey | DRODSWRTJJIOKE-CGXWXWIYSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|