C9H13NO — CID 142527860
(2E)-2-ethenyl-N,4-dimethylpenta-2,4-dienamide (PubChem CID 142527860) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (2E)-2-ethenyl-N,4-dimethylpenta-2,4-dienamide.
| Compound Name | (2E)-2-ethenyl-N,4-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 142527860 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (2E)-2-ethenyl-N,4-dimethylpenta-2,4-dienamide |
| SMILES | C=C/C(=C\C(=C)C)C(=O)NC |
| InChI | InChI=1S/C9H13NO/c1-5-8(6-7(2)3)9(11)10-4/h5-6H,1-2H2,3-4H3,(H,10,11)/b8-6+ |
| InChIKey | IEZHWXSEOZEJBS-SOFGYWHQSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|