C7H15NO — CID 142291054
N,2-dimethylprop-2-enamide;ethane (PubChem CID 142291054) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is N,2-dimethylprop-2-enamide;ethane.
| Compound Name | N,2-dimethylprop-2-enamide;ethane |
|---|---|
| PubChem CID | 142291054 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | N,2-dimethylprop-2-enamide;ethane |
| SMILES | C=C(C)C(=O)NC.CC |
| InChI | InChI=1S/C5H9NO.C2H6/c1-4(2)5(7)6-3;1-2/h1H2,2-3H3,(H,6,7);1-2H3 |
| InChIKey | IVCJVSIZERMTRJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|