About ethane;methane;N-methylacetamide
ethane;methane;N-methylacetamide (PubChem CID 159401147) has the molecular formula C6H17NO
and a molecular weight of 119.21 g/mol. Its IUPAC name is ethane;methane;N-methylacetamide.
Molecular Properties
| Compound Name | ethane;methane;N-methylacetamide |
| PubChem CID | 159401147 |
| Molecular Formula | C6H17NO |
| Molecular Weight | 119.21 g/mol |
| Exact Mass | 119.13 |
| IUPAC Name | ethane;methane;N-methylacetamide |
| SMILES | C.CC.CNC(C)=O |
| InChI | InChI=1S/C3H7NO.C2H6.CH4/c1-3(5)4-2;1-2;/h1-2H3,(H,4,5);1-2H3;1H4 |
| InChIKey | LNIVLXDJCVUIJQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methane;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;N-methylacetamide?
The IUPAC name of ethane;methane;N-methylacetamide (CID 159401147) is ethane;methane;N-methylacetamide.
What is the SMILES notation for ethane;methane;N-methylacetamide?
The canonical SMILES for ethane;methane;N-methylacetamide is C.CC.CNC(C)=O.
What is the InChIKey of ethane;methane;N-methylacetamide?
The InChIKey is LNIVLXDJCVUIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H6.CH4/c1-3(5)4-2;1-2;/h1-2H3,(H,4,5);1-2H3;1H4.
What are the key properties of ethane;methane;N-methylacetamide?
ethane;methane;N-methylacetamide has a molecular weight of 119.21 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;N-methylacetamide is sourced from PubChem (CID 159401147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).