About formaldehyde;N-methylacetamide
formaldehyde;N-methylacetamide (PubChem CID 159490973) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is formaldehyde;N-methylacetamide.
Molecular Properties
| Compound Name | formaldehyde;N-methylacetamide |
| PubChem CID | 159490973 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | formaldehyde;N-methylacetamide |
| SMILES | C=O.CNC(C)=O |
| InChI | InChI=1S/C3H7NO.CH2O/c1-3(5)4-2;1-2/h1-2H3,(H,4,5);1H2 |
| InChIKey | LYEMXWNULOHRMM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze formaldehyde;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;N-methylacetamide?
The IUPAC name of formaldehyde;N-methylacetamide (CID 159490973) is formaldehyde;N-methylacetamide.
What is the SMILES notation for formaldehyde;N-methylacetamide?
The canonical SMILES for formaldehyde;N-methylacetamide is C=O.CNC(C)=O.
What is the InChIKey of formaldehyde;N-methylacetamide?
The InChIKey is LYEMXWNULOHRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CH2O/c1-3(5)4-2;1-2/h1-2H3,(H,4,5);1H2.
What are the key properties of formaldehyde;N-methylacetamide?
formaldehyde;N-methylacetamide has a molecular weight of 103.12 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;N-methylacetamide is sourced from PubChem (CID 159490973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).