About N-methylacetamide;propan-2-ylazanium
N-methylacetamide;propan-2-ylazanium (PubChem CID 158450921) has the molecular formula C6H17N2O+
and a molecular weight of 133.22 g/mol. Its IUPAC name is N-methylacetamide;propan-2-ylazanium.
Molecular Properties
| Compound Name | N-methylacetamide;propan-2-ylazanium |
| PubChem CID | 158450921 |
| Molecular Formula | C6H17N2O+ |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.13 |
| IUPAC Name | N-methylacetamide;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].CNC(C)=O |
| InChI | InChI=1S/C3H7NO.C3H9N/c1-3(5)4-2;1-3(2)4/h1-2H3,(H,4,5);3H,4H2,1-2H3/p+1 |
| InChIKey | HDYWMWCPYQFQPM-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylacetamide;propan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;propan-2-ylazanium?
The IUPAC name of N-methylacetamide;propan-2-ylazanium (CID 158450921) is N-methylacetamide;propan-2-ylazanium.
What is the SMILES notation for N-methylacetamide;propan-2-ylazanium?
The canonical SMILES for N-methylacetamide;propan-2-ylazanium is CC(C)[NH3+].CNC(C)=O.
What is the InChIKey of N-methylacetamide;propan-2-ylazanium?
The InChIKey is HDYWMWCPYQFQPM-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7NO.C3H9N/c1-3(5)4-2;1-3(2)4/h1-2H3,(H,4,5);3H,4H2,1-2H3/p+1.
What are the key properties of N-methylacetamide;propan-2-ylazanium?
N-methylacetamide;propan-2-ylazanium has a molecular weight of 133.22 g/mol, XLogP of -0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;propan-2-ylazanium is sourced from PubChem (CID 158450921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).