About bis(N-methylacetamide);propan-2-one
bis(N-methylacetamide);propan-2-one (PubChem CID 158104043) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is bis(N-methylacetamide);propan-2-one.
Molecular Properties
| Compound Name | bis(N-methylacetamide);propan-2-one |
| PubChem CID | 158104043 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | bis(N-methylacetamide);propan-2-one |
| SMILES | CC(C)=O.CNC(C)=O.CNC(C)=O |
| InChI | InChI=1S/2C3H7NO.C3H6O/c2*1-3(5)4-2;1-3(2)4/h2*1-2H3,(H,4,5);1-2H3 |
| InChIKey | FPPPUAVRASTBTQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(N-methylacetamide);propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-methylacetamide);propan-2-one?
The IUPAC name of bis(N-methylacetamide);propan-2-one (CID 158104043) is bis(N-methylacetamide);propan-2-one.
What is the SMILES notation for bis(N-methylacetamide);propan-2-one?
The canonical SMILES for bis(N-methylacetamide);propan-2-one is CC(C)=O.CNC(C)=O.CNC(C)=O.
What is the InChIKey of bis(N-methylacetamide);propan-2-one?
The InChIKey is FPPPUAVRASTBTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7NO.C3H6O/c2*1-3(5)4-2;1-3(2)4/h2*1-2H3,(H,4,5);1-2H3.
What are the key properties of bis(N-methylacetamide);propan-2-one?
bis(N-methylacetamide);propan-2-one has a molecular weight of 204.27 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-methylacetamide);propan-2-one is sourced from PubChem (CID 158104043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).