About potassium;hydride;N-methylacetamide
potassium;hydride;N-methylacetamide (PubChem CID 173418413) has the molecular formula C3H8KNO
and a molecular weight of 113.20 g/mol. Its IUPAC name is potassium;hydride;N-methylacetamide.
Molecular Properties
| Compound Name | potassium;hydride;N-methylacetamide |
| PubChem CID | 173418413 |
| Molecular Formula | C3H8KNO |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | potassium;hydride;N-methylacetamide |
| SMILES | CNC(C)=O.[H-].[K+] |
| InChI | InChI=1S/C3H7NO.K.H/c1-3(5)4-2;;/h1-2H3,(H,4,5);;/q;+1;-1 |
| InChIKey | GLZHVDFPSVJAPV-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;hydride;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;N-methylacetamide?
The IUPAC name of potassium;hydride;N-methylacetamide (CID 173418413) is potassium;hydride;N-methylacetamide.
What is the SMILES notation for potassium;hydride;N-methylacetamide?
The canonical SMILES for potassium;hydride;N-methylacetamide is CNC(C)=O.[H-].[K+].
What is the InChIKey of potassium;hydride;N-methylacetamide?
The InChIKey is GLZHVDFPSVJAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.K.H/c1-3(5)4-2;;/h1-2H3,(H,4,5);;/q;+1;-1.
What are the key properties of potassium;hydride;N-methylacetamide?
potassium;hydride;N-methylacetamide has a molecular weight of 113.20 g/mol, XLogP of -3.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;N-methylacetamide is sourced from PubChem (CID 173418413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).