About N-methylacetamide;pentane-2,4-dione;bis(propan-2-one)
N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) (PubChem CID 91069648) has the molecular formula C14H27NO5
and a molecular weight of 289.37 g/mol. Its IUPAC name is N-methylacetamide;pentane-2,4-dione;bis(propan-2-one).
Molecular Properties
| Compound Name | N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) |
| PubChem CID | 91069648 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) |
| SMILES | CC(=O)CC(C)=O.CC(C)=O.CC(C)=O.CNC(C)=O |
| InChI | InChI=1S/C5H8O2.C3H7NO.2C3H6O/c1-4(6)3-5(2)7;1-3(5)4-2;2*1-3(2)4/h3H2,1-2H3;1-2H3,(H,4,5);2*1-2H3 |
| InChIKey | CUKYTINAELCBFB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;pentane-2,4-dione;bis(propan-2-one)?
The IUPAC name of N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) (CID 91069648) is N-methylacetamide;pentane-2,4-dione;bis(propan-2-one).
What is the SMILES notation for N-methylacetamide;pentane-2,4-dione;bis(propan-2-one)?
The canonical SMILES for N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) is CC(=O)CC(C)=O.CC(C)=O.CC(C)=O.CNC(C)=O.
What is the InChIKey of N-methylacetamide;pentane-2,4-dione;bis(propan-2-one)?
The InChIKey is CUKYTINAELCBFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C3H7NO.2C3H6O/c1-4(6)3-5(2)7;1-3(5)4-2;2*1-3(2)4/h3H2,1-2H3;1-2H3,(H,4,5);2*1-2H3.
What are the key properties of N-methylacetamide;pentane-2,4-dione;bis(propan-2-one)?
N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) has a molecular weight of 289.37 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;pentane-2,4-dione;bis(propan-2-one) is sourced from PubChem (CID 91069648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).