About pentane-2,4-dione;propan-2-one;ruthenium
pentane-2,4-dione;propan-2-one;ruthenium (PubChem CID 175213221) has the molecular formula C8H14O3Ru
and a molecular weight of 259.27 g/mol. Its IUPAC name is pentane-2,4-dione;propan-2-one;ruthenium.
Molecular Properties
| Compound Name | pentane-2,4-dione;propan-2-one;ruthenium |
| PubChem CID | 175213221 |
| Molecular Formula | C8H14O3Ru |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | pentane-2,4-dione;propan-2-one;ruthenium |
| SMILES | CC(=O)CC(C)=O.CC(C)=O.[Ru] |
| InChI | InChI=1S/C5H8O2.C3H6O.Ru/c1-4(6)3-5(2)7;1-3(2)4;/h3H2,1-2H3;1-2H3; |
| InChIKey | DUUVXRMIVYIVCX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-dione;propan-2-one;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-dione;propan-2-one;ruthenium?
The IUPAC name of pentane-2,4-dione;propan-2-one;ruthenium (CID 175213221) is pentane-2,4-dione;propan-2-one;ruthenium.
What is the SMILES notation for pentane-2,4-dione;propan-2-one;ruthenium?
The canonical SMILES for pentane-2,4-dione;propan-2-one;ruthenium is CC(=O)CC(C)=O.CC(C)=O.[Ru].
What is the InChIKey of pentane-2,4-dione;propan-2-one;ruthenium?
The InChIKey is DUUVXRMIVYIVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C3H6O.Ru/c1-4(6)3-5(2)7;1-3(2)4;/h3H2,1-2H3;1-2H3;.
What are the key properties of pentane-2,4-dione;propan-2-one;ruthenium?
pentane-2,4-dione;propan-2-one;ruthenium has a molecular weight of 259.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;propan-2-one;ruthenium is sourced from PubChem (CID 175213221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).