About N-methylacetamide;phosphoric acid
N-methylacetamide;phosphoric acid (PubChem CID 174660683) has the molecular formula C3H10NO5P
and a molecular weight of 171.09 g/mol. Its IUPAC name is N-methylacetamide;phosphoric acid.
Molecular Properties
| Compound Name | N-methylacetamide;phosphoric acid |
| PubChem CID | 174660683 |
| Molecular Formula | C3H10NO5P |
| Molecular Weight | 171.09 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | N-methylacetamide;phosphoric acid |
| SMILES | CNC(C)=O.O=P(O)(O)O |
| InChI | InChI=1S/C3H7NO.H3O4P/c1-3(5)4-2;1-5(2,3)4/h1-2H3,(H,4,5);(H3,1,2,3,4) |
| InChIKey | SDJRGOGDQBXMMW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.09 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-methylacetamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;phosphoric acid?
The IUPAC name of N-methylacetamide;phosphoric acid (CID 174660683) is N-methylacetamide;phosphoric acid.
What is the SMILES notation for N-methylacetamide;phosphoric acid?
The canonical SMILES for N-methylacetamide;phosphoric acid is CNC(C)=O.O=P(O)(O)O.
What is the InChIKey of N-methylacetamide;phosphoric acid?
The InChIKey is SDJRGOGDQBXMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.H3O4P/c1-3(5)4-2;1-5(2,3)4/h1-2H3,(H,4,5);(H3,1,2,3,4).
What are the key properties of N-methylacetamide;phosphoric acid?
N-methylacetamide;phosphoric acid has a molecular weight of 171.09 g/mol, XLogP of -1.18, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;phosphoric acid is sourced from PubChem (CID 174660683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).