acetic acid;cobalt;phosphoric acid

C2H10Co4O10P2 — CID 174842184

IUPACacetic acid;cobalt;phosphoric acid
SMILESCC(=O)O.O=P(O)(O)O.O=P(O)(O)O.[Co].[Co].[Co].[Co]
InChIInChI=1S/C2H4O2.4Co.2H3O4P/c1-2(3)4;;;;;2*1-5(2,3)4/h1H3,(H,3,4);;;;;2*(H3,1,2,3,4)
InChIKeyQRXBDIVQVSPMFR-UHFFFAOYSA-N
MW491.77 g/mol
LogP-1.78
Rot. Bonds

About acetic acid;cobalt;phosphoric acid

acetic acid;cobalt;phosphoric acid (PubChem CID 174842184) has the molecular formula C2H10Co4O10P2 and a molecular weight of 491.77 g/mol. Its IUPAC name is acetic acid;cobalt;phosphoric acid.

Molecular Properties

Compound Nameacetic acid;cobalt;phosphoric acid
PubChem CID174842184
Molecular FormulaC2H10Co4O10P2
Molecular Weight491.77 g/mol
Exact Mass491.71
IUPAC Nameacetic acid;cobalt;phosphoric acid
SMILESCC(=O)O.O=P(O)(O)O.O=P(O)(O)O.[Co].[Co].[Co].[Co]
InChIInChI=1S/C2H4O2.4Co.2H3O4P/c1-2(3)4;;;;;2*1-5(2,3)4/h1H3,(H,3,4);;;;;2*(H3,1,2,3,4)
InChIKeyQRXBDIVQVSPMFR-UHFFFAOYSA-N
XLogP-1.78
TPSA192.82 Ų
H-Bond Donors7
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500491.77
LogP ≤ 5-1.78
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze acetic acid;cobalt;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

potassium;acetic acid;hydride;phosphoric acid
CID 173226797
acetic acid;azane;phosphoric acid;zinc
CID 174918986
tetrasodium;acetic acid;azane;hydride;phosphoric acid
CID 173436604
acetic acid;boric acid;phosphoric acid
CID 87603832
acetic acid;ethane-1,2-diol;phosphoric acid
CID 161248313
acetic acid;cobalt
CID 59294242
acetic acid;cobalt
CID 54602348
acetic acid;phosphono dihydrogen phosphate;phosphoric acid
CID 88733603
acetic acid;phosphoric acid;propanoic acid
CID 162090044
methanol;phosphoric acid;propan-2-one
CID 134563724
calcium;acetic acid;hydrogen phosphate
CID 155194224
acetic acid;cobalt;molybdenum
CID 174687861

Frequently Asked Questions

What is the IUPAC name of acetic acid;cobalt;phosphoric acid?
The IUPAC name of acetic acid;cobalt;phosphoric acid (CID 174842184) is acetic acid;cobalt;phosphoric acid.
What is the SMILES notation for acetic acid;cobalt;phosphoric acid?
The canonical SMILES for acetic acid;cobalt;phosphoric acid is CC(=O)O.O=P(O)(O)O.O=P(O)(O)O.[Co].[Co].[Co].[Co].
What is the InChIKey of acetic acid;cobalt;phosphoric acid?
The InChIKey is QRXBDIVQVSPMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.4Co.2H3O4P/c1-2(3)4;;;;;2*1-5(2,3)4/h1H3,(H,3,4);;;;;2*(H3,1,2,3,4).
What are the key properties of acetic acid;cobalt;phosphoric acid?
acetic acid;cobalt;phosphoric acid has a molecular weight of 491.77 g/mol, XLogP of -1.78, 0 rotatable bonds, 7 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;cobalt;phosphoric acid is sourced from PubChem (CID 174842184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).