About N,N-diethylethanamine;N-methylacetamide
N,N-diethylethanamine;N-methylacetamide (PubChem CID 19745535) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is N,N-diethylethanamine;N-methylacetamide.
Molecular Properties
| Compound Name | N,N-diethylethanamine;N-methylacetamide |
| PubChem CID | 19745535 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | N,N-diethylethanamine;N-methylacetamide |
| SMILES | CCN(CC)CC.CNC(C)=O |
| InChI | InChI=1S/C6H15N.C3H7NO/c1-4-7(5-2)6-3;1-3(5)4-2/h4-6H2,1-3H3;1-2H3,(H,4,5) |
| InChIKey | XNBGAUKNZOSUOG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;N-methylacetamide?
The IUPAC name of N,N-diethylethanamine;N-methylacetamide (CID 19745535) is N,N-diethylethanamine;N-methylacetamide.
What is the SMILES notation for N,N-diethylethanamine;N-methylacetamide?
The canonical SMILES for N,N-diethylethanamine;N-methylacetamide is CCN(CC)CC.CNC(C)=O.
What is the InChIKey of N,N-diethylethanamine;N-methylacetamide?
The InChIKey is XNBGAUKNZOSUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H7NO/c1-4-7(5-2)6-3;1-3(5)4-2/h4-6H2,1-3H3;1-2H3,(H,4,5).
What are the key properties of N,N-diethylethanamine;N-methylacetamide?
N,N-diethylethanamine;N-methylacetamide has a molecular weight of 174.29 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;N-methylacetamide is sourced from PubChem (CID 19745535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).