C9H22N2O — CID 19745535
N,N-diethylethanamine;N-methylacetamide (PubChem CID 19745535) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is N,N-diethylethanamine;N-methylacetamide.
| Compound Name | N,N-diethylethanamine;N-methylacetamide |
|---|---|
| PubChem CID | 19745535 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | N,N-diethylethanamine;N-methylacetamide |
| SMILES | CCN(CC)CC.CNC(C)=O |
| InChI | InChI=1S/C6H15N.C3H7NO/c1-4-7(5-2)6-3;1-3(5)4-2/h4-6H2,1-3H3;1-2H3,(H,4,5) |
| InChIKey | XNBGAUKNZOSUOG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |